Urolithin B bột

Tháng Mười Một 9, 2020

Cofttek là nhà sản xuất bột Urolithin B tốt nhất ở Trung Quốc. Nhà máy của chúng tôi có hệ thống quản lý sản xuất hoàn chỉnh (ISO9001 & ISO14001), với công suất sản xuất hàng tháng là 200kg.

 


Tình trạng: Trong sản xuất hàng loạt
Đơn vị tính: 1kg / bao, 25kg / thùng

Urolithin BSpecifications

Tên: Urolithin B
Tên hóa học: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Công thức hóa học: C13H8O3
Trọng lượng phân tử: X
Màu:  Bột trắng
Khóa InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
Mã SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Chức năng: Urolithin B có thể cải thiện chức năng của ty thể và cơ bắp.

Urolithin B có thể cải thiện sức mạnh và độ bền của cơ trong quá trình lão hóa.

Ứng dụng: Urolithin B là một chất chuyển hóa của vi sinh vật đường ruột của ellagitannis và thể hiện các hoạt tính chống oxy hóa và chống oxy hóa mạnh tùy thuộc vào hệ thống xét nghiệm và điều kiện. Urolithin B cũng có thể hiển thị hoạt động estrogen và / hoặc kháng estrogen.
Độ hòa tan: Dễ dàng hòa tan trong N, N-đimetylformamit và đimetylmetylen. Sulfone, hòa tan nhẹ trong metanol, etanol và etyl axetat
Nhiệt độ lưu trữ: Hút ẩm, -20 ° C Tủ đông, Dưới bầu không khí trơ
Điều kiện vận chuyển: Vận chuyển dưới nhiệt độ môi trường xung quanh là hóa chất không độc hại. Sản phẩm này đủ ổn định trong một vài tuần trong thời gian vận chuyển thông thường và thời gian sử dụng trong Hải quan.

 

Urolithin B Phổ NMR

Urolithin B (1139-83-9) - Phổ NMR

 

Nếu bạn cần COA, MSDS, HNMR cho từng lô sản phẩm và các thông tin khác, vui lòng liên hệ với chúng tôi quản lý tiếp thị.